ChemNet > CAS > 13321-74-9 1-bromo-2,5-dimetossi-4-metilbenzene
13321-74-9 1-bromo-2,5-dimetossi-4-metilbenzene
| Nome del prodotto |
1-bromo-2,5-dimetossi-4-metilbenzene |
| Nome inglese |
1-bromo-2,5-dimethoxy-4-methylbenzene; |
| Formula molecolare |
C9H11BrO2 |
| Peso Molecolare |
231.0864 |
| InChI |
InChI=1/C9H11BrO2/c1-6-4-9(12-3)7(10)5-8(6)11-2/h4-5H,1-3H3 |
| Numero CAS |
13321-74-9 |
| Struttura molecolare |
|
| Densità |
1.36g/cm3 |
| Punto di fusione |
77℃ |
| Punto di ebollizione |
270.4°C at 760 mmHg |
| Indice di rifrazione |
1.525 |
| Punto d'infiammabilità |
114.1°C |
| Pressione di vapore |
0.0114mmHg at 25°C |
| Simboli di pericolo |
Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|